C18H18B3FN2O4S — CID 174089453
CID 174089453 (PubChem CID 174089453) has the molecular formula C18H18B3FN2O4S and a molecular weight of 409.85 g/mol.
| Compound Name | CID 174089453 |
|---|---|
| PubChem CID | 174089453 |
| Molecular Formula | C18H18B3FN2O4S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1CCO[C@@H](COc2cc(C(=O)OC)c(F)c(-c3ncc(C)s3)c2)C1 |
| InChI | InChI=1S/C18H18B3FN2O4S/c1-10-7-23-16(29-10)13-5-11(6-14(15(13)22)17(25)26-2)28-9-12-8-24(3-4-27-12)18(19,20)21/h5-7,12H,3-4,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | MUIOWCYRCAUXQH-GFCCVEGCSA-N |
| XLogP | 1.24 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|