C17H18BF6NO7S — CID 174093762
CID 174093762 (PubChem CID 174093762) has the molecular formula C17H18BF6NO7S and a molecular weight of 505.20 g/mol.
| Compound Name | CID 174093762 |
|---|---|
| PubChem CID | 174093762 |
| Molecular Formula | C17H18BF6NO7S |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)ccc1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H18BF6NO7S/c1-14(2,3)32-13(27)25(4)11-6-5-9(7-10(11)18)12(26)31-15(16(19,20)21,17(22,23)24)8-33(28,29)30/h5-7H,8H2,1-4H3,(H,28,29,30) |
| InChIKey | KDQHTJDTSGCMHI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|