C13H9B3F6O5S — CID 174093755
CID 174093755 (PubChem CID 174093755) has the molecular formula C13H9B3F6O5S and a molecular weight of 423.70 g/mol.
| Compound Name | CID 174093755 |
|---|---|
| PubChem CID | 174093755 |
| Molecular Formula | C13H9B3F6O5S |
| Molecular Weight | 423.70 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc([B])cc(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c1C[B] |
| InChI | InChI=1S/C13H9B3F6O5S/c14-3-6-1-7(16)2-8(9(6)4-15)10(23)27-11(12(17,18)19,13(20,21)22)5-28(24,25)26/h1-2H,3-5H2,(H,24,25,26) |
| InChIKey | SAWHWBVEKQWUGX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.70 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|