C16H14BF6NO7S — CID 158038663
CID 158038663 (PubChem CID 158038663) has the molecular formula C16H14BF6NO7S and a molecular weight of 489.16 g/mol.
| Compound Name | CID 158038663 |
|---|---|
| PubChem CID | 158038663 |
| Molecular Formula | C16H14BF6NO7S |
| Molecular Weight | 489.16 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)OCC=C |
| InChI | InChI=1S/C16H14BF6NO7S/c1-2-5-30-13(26)24-11-4-3-9(6-10(11)7-17)12(25)31-14(15(18,19)20,16(21,22)23)8-32(27,28)29/h2-4,6H,1,5,7-8H2,(H,24,26)(H,27,28,29) |
| InChIKey | UFGDGKLWBIELTB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|