C14H13F3IN2O6S- — CID 162466909
2-[3-iodo-4-(prop-2-enoxycarbonylamino)benzoyl]oxyethyl-(trifluoromethylsulfonyl)azanide (PubChem CID 162466909) has the molecular formula C14H13F3IN2O6S- and a molecular weight of 521.23 g/mol. Its IUPAC name is 2-[3-iodo-4-(prop-2-enoxycarbonylamino)benzoyl]oxyethyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-[3-iodo-4-(prop-2-enoxycarbonylamino)benzoyl]oxyethyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 162466909 |
| Molecular Formula | C14H13F3IN2O6S- |
| Molecular Weight | 521.23 g/mol |
| Exact Mass | 520.95 |
| IUPAC Name | 2-[3-iodo-4-(prop-2-enoxycarbonylamino)benzoyl]oxyethyl-(trifluoromethylsulfonyl)azanide |
| SMILES | C=CCOC(=O)Nc1ccc(C(=O)OCC[N-]S(=O)(=O)C(F)(F)F)cc1I |
| InChI | InChI=1S/C14H13F3IN2O6S/c1-2-6-26-13(22)20-11-4-3-9(8-10(11)18)12(21)25-7-5-19-27(23,24)14(15,16)17/h2-4,8H,1,5-7H2,(H,20,21,22)/q-1 |
| InChIKey | SHWTXDZFQSNLDL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|