C12H10F3INO6S- — CID 162466851
2-(3-acetyloxy-4-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide (PubChem CID 162466851) has the molecular formula C12H10F3INO6S- and a molecular weight of 480.18 g/mol. Its IUPAC name is 2-(3-acetyloxy-4-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(3-acetyloxy-4-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 162466851 |
| Molecular Formula | C12H10F3INO6S- |
| Molecular Weight | 480.18 g/mol |
| Exact Mass | 479.92 |
| IUPAC Name | 2-(3-acetyloxy-4-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC(=O)Oc1cc(C(=O)OCC[N-]S(=O)(=O)C(F)(F)F)ccc1I |
| InChI | InChI=1S/C12H10F3INO6S/c1-7(18)23-10-6-8(2-3-9(10)16)11(19)22-5-4-17-24(20,21)12(13,14)15/h2-3,6H,4-5H2,1H3/q-1 |
| InChIKey | IXXFWOBCMPIAJR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|