C10H8F3INO4S- — CID 162466929
2-(2-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide (PubChem CID 162466929) has the molecular formula C10H8F3INO4S- and a molecular weight of 422.14 g/mol. Its IUPAC name is 2-(2-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(2-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 162466929 |
| Molecular Formula | C10H8F3INO4S- |
| Molecular Weight | 422.14 g/mol |
| Exact Mass | 421.92 |
| IUPAC Name | 2-(2-iodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=C(OCC[N-]S(=O)(=O)C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C10H8F3INO4S/c11-10(12,13)20(17,18)15-5-6-19-9(16)7-3-1-2-4-8(7)14/h1-4H,5-6H2/q-1 |
| InChIKey | DEZVWGVMFMOJNE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|