C11H10IN5O2 — CID 8601845
(4,6-diamino-1,3,5-triazin-2-yl)methyl 2-iodobenzoate (PubChem CID 8601845) has the molecular formula C11H10IN5O2 and a molecular weight of 371.14 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-iodobenzoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-iodobenzoate |
|---|---|
| PubChem CID | 8601845 |
| Molecular Formula | C11H10IN5O2 |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-iodobenzoate |
| SMILES | Nc1nc(N)nc(COC(=O)c2ccccc2I)n1 |
| InChI | InChI=1S/C11H10IN5O2/c12-7-4-2-1-3-6(7)9(18)19-5-8-15-10(13)17-11(14)16-8/h1-4H,5H2,(H4,13,14,15,16,17) |
| InChIKey | OJVASHHIGNZADS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|