C17H16B3F6NO5S — CID 167636295
CID 167636295 (PubChem CID 167636295) has the molecular formula C17H16B3F6NO5S and a molecular weight of 492.81 g/mol.
| Compound Name | CID 167636295 |
|---|---|
| PubChem CID | 167636295 |
| Molecular Formula | C17H16B3F6NO5S |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C(=O)OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c(C[B])c1NC(=C)C |
| InChI | InChI=1S/C17H16B3F6NO5S/c1-8(2)27-13-10(5-19)3-9(4-18)12(11(13)6-20)14(28)32-15(16(21,22)23,17(24,25)26)7-33(29,30)31/h3,27H,1,4-7H2,2H3,(H,29,30,31) |
| InChIKey | INPBFOOXTBABBB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|