C24H18F6O7S — CID 155323482
2-[2-[bis(4-hydroxyphenyl)methyl]benzoyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid (PubChem CID 155323482) has the molecular formula C24H18F6O7S and a molecular weight of 564.46 g/mol. Its IUPAC name is 2-[2-[bis(4-hydroxyphenyl)methyl]benzoyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid.
| Compound Name | 2-[2-[bis(4-hydroxyphenyl)methyl]benzoyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 155323482 |
| Molecular Formula | C24H18F6O7S |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 2-[2-[bis(4-hydroxyphenyl)methyl]benzoyl]oxy-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonic acid |
| SMILES | O=C(OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H18F6O7S/c25-23(26,27)22(24(28,29)30,13-38(34,35)36)37-21(33)19-4-2-1-3-18(19)20(14-5-9-16(31)10-6-14)15-7-11-17(32)12-8-15/h1-12,20,31-32H,13H2,(H,34,35,36) |
| InChIKey | ZDUPYOYHNHBYEW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|