C11H9BF6O4S — CID 157177011
CID 157177011 (PubChem CID 157177011) has the molecular formula C11H9BF6O4S and a molecular weight of 362.06 g/mol.
| Compound Name | CID 157177011 |
|---|---|
| PubChem CID | 157177011 |
| Molecular Formula | C11H9BF6O4S |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | — |
| SMILES | [B]Cc1cccc(OC(CS(=O)(=O)O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BF6O4S/c12-5-7-2-1-3-8(4-7)22-9(10(13,14)15,11(16,17)18)6-23(19,20)21/h1-4H,5-6H2,(H,19,20,21) |
| InChIKey | OTMXNLVAELBQPE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|