About CID 158834282
CID 158834282 (PubChem CID 158834282) has the molecular formula C12H9B3F6O4S
and a molecular weight of 395.69 g/mol.
Molecular Properties
| Compound Name | CID 158834282 |
| PubChem CID | 158834282 |
| Molecular Formula | C12H9B3F6O4S |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(OC(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O)c(C[B])c1 |
| InChI | InChI=1S/C12H9B3F6O4S/c13-3-6-1-7(4-14)9(8(2-6)5-15)25-10(11(16,17)18,12(19,20)21)26(22,23)24/h1-2H,3-5H2,(H,22,23,24) |
| InChIKey | BQVXMANGXXVHJI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158834282 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158834282?
The IUPAC name of CID 158834282 (CID 158834282) is not available.
What is the SMILES notation for CID 158834282?
The canonical SMILES for CID 158834282 is [B]Cc1cc(C[B])c(OC(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O)c(C[B])c1.
What is the InChIKey of CID 158834282?
The InChIKey is BQVXMANGXXVHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9B3F6O4S/c13-3-6-1-7(4-14)9(8(2-6)5-15)25-10(11(16,17)18,12(19,20)21)26(22,23)24/h1-2H,3-5H2,(H,22,23,24).
What are the key properties of CID 158834282?
CID 158834282 has a molecular weight of 395.69 g/mol, XLogP of 1.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158834282 is sourced from PubChem (CID 158834282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).