C10H10BrF3O4S — CID 159924139
2-(3-bromophenoxy)-3,3,3-trifluoro-2-methylpropane-1-sulfonic acid (PubChem CID 159924139) has the molecular formula C10H10BrF3O4S and a molecular weight of 363.15 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-3,3,3-trifluoro-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-(3-bromophenoxy)-3,3,3-trifluoro-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159924139 |
| Molecular Formula | C10H10BrF3O4S |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | 2-(3-bromophenoxy)-3,3,3-trifluoro-2-methylpropane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)(Oc1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3O4S/c1-9(10(12,13)14,6-19(15,16)17)18-8-4-2-3-7(11)5-8/h2-5H,6H2,1H3,(H,15,16,17) |
| InChIKey | JQMNYWOAXMYLBM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|