C14H19BrO3 — CID 70024558
2-(3-bromophenoxy)-2,4,4-trimethylpentanoic acid (PubChem CID 70024558) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-2,4,4-trimethylpentanoic acid.
| Compound Name | 2-(3-bromophenoxy)-2,4,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 70024558 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-(3-bromophenoxy)-2,4,4-trimethylpentanoic acid |
| SMILES | CC(C)(C)CC(C)(Oc1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H19BrO3/c1-13(2,3)9-14(4,12(16)17)18-11-7-5-6-10(15)8-11/h5-8H,9H2,1-4H3,(H,16,17) |
| InChIKey | XKAFOEYCNSLZBJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |