C20H13F7N6 — CID 174093880
5-[1-amino-3-(2,2,3,3,4,4,4-heptafluorobutylimino)prop-1-en-2-yl]-6-imidazo[1,2-a]pyridin-7-ylpyridine-2-carbonitrile (PubChem CID 174093880) has the molecular formula C20H13F7N6 and a molecular weight of 470.35 g/mol. Its IUPAC name is 5-[1-amino-3-(2,2,3,3,4,4,4-heptafluorobutylimino)prop-1-en-2-yl]-6-imidazo[1,2-a]pyridin-7-ylpyridine-2-carbonitrile.
| Compound Name | 5-[1-amino-3-(2,2,3,3,4,4,4-heptafluorobutylimino)prop-1-en-2-yl]-6-imidazo[1,2-a]pyridin-7-ylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 174093880 |
| Molecular Formula | C20H13F7N6 |
| Molecular Weight | 470.35 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 5-[1-amino-3-(2,2,3,3,4,4,4-heptafluorobutylimino)prop-1-en-2-yl]-6-imidazo[1,2-a]pyridin-7-ylpyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(C(=CN)/C=N/CC(F)(F)C(F)(F)C(F)(F)F)c(-c2ccn3ccnc3c2)n1 |
| InChI | InChI=1S/C20H13F7N6/c21-18(22,19(23,24)20(25,26)27)11-30-10-13(8-28)15-2-1-14(9-29)32-17(15)12-3-5-33-6-4-31-16(33)7-12/h1-8,10H,11,28H2/b13-8?,30-10+ |
| InChIKey | HUEQDLGJSZKQSI-FEFFXOPRSA-N |
| XLogP | 4.47 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|