C21H20F3N7 — CID 174093984
5-[1-amino-3-(3,3,3-trifluoro-2,2-dimethylpropyl)iminoprop-1-en-2-yl]-6-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-2-carbonitrile (PubChem CID 174093984) has the molecular formula C21H20F3N7 and a molecular weight of 427.43 g/mol. Its IUPAC name is 5-[1-amino-3-(3,3,3-trifluoro-2,2-dimethylpropyl)iminoprop-1-en-2-yl]-6-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-2-carbonitrile.
| Compound Name | 5-[1-amino-3-(3,3,3-trifluoro-2,2-dimethylpropyl)iminoprop-1-en-2-yl]-6-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 174093984 |
| Molecular Formula | C21H20F3N7 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 5-[1-amino-3-(3,3,3-trifluoro-2,2-dimethylpropyl)iminoprop-1-en-2-yl]-6-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)pyridine-2-carbonitrile |
| SMILES | Cc1nc2cc(-c3nc(C#N)ccc3C(=CN)/C=N/CC(C)(C)C(F)(F)F)ccn2n1 |
| InChI | InChI=1S/C21H20F3N7/c1-13-28-18-8-14(6-7-31(18)30-13)19-17(5-4-16(10-26)29-19)15(9-25)11-27-12-20(2,3)21(22,23)24/h4-9,11H,12,25H2,1-3H3/b15-9?,27-11+ |
| InChIKey | TWOVWCVWKHHMHY-FTIOWYAXSA-N |
| XLogP | 3.93 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|