C18H25BN2O3S — CID 174096065
N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pentanamide (PubChem CID 174096065) has the molecular formula C18H25BN2O3S and a molecular weight of 360.29 g/mol. Its IUPAC name is N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pentanamide.
| Compound Name | N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 174096065 |
| Molecular Formula | C18H25BN2O3S |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2s1 |
| InChI | InChI=1S/C18H25BN2O3S/c1-6-7-8-15(22)21-16-20-13-10-9-12(11-14(13)25-16)19-23-17(2,3)18(4,5)24-19/h9-11H,6-8H2,1-5H3,(H,20,21,22) |
| InChIKey | WXPKLDMCZZDBKH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|