C24H24BN — CID 174098007
CID 174098007 (PubChem CID 174098007) has the molecular formula C24H24BN and a molecular weight of 337.28 g/mol.
| Compound Name | CID 174098007 |
|---|---|
| PubChem CID | 174098007 |
| Molecular Formula | C24H24BN |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | — |
| SMILES | [B]C1(c2ccc(-c3ccnc(-c4ccccc4)c3)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C24H24BN/c1-18-6-5-14-24(25,17-18)22-11-9-19(10-12-22)21-13-15-26-23(16-21)20-7-3-2-4-8-20/h2-4,7-13,15-16,18H,5-6,14,17H2,1H3 |
| InChIKey | ZQZDGVHFTCPYHH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|