About CID 174098549
CID 174098549 (PubChem CID 174098549) has the molecular formula C19H39BO2
and a molecular weight of 310.33 g/mol.
Molecular Properties
| Compound Name | CID 174098549 |
| PubChem CID | 174098549 |
| Molecular Formula | C19H39BO2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | — |
| SMILES | [B]CCC(CCOC(CCC)CCC)OC(CCC)CCC |
| InChI | InChI=1S/C19H39BO2/c1-5-9-17(10-6-2)21-16-14-19(13-15-20)22-18(11-7-3)12-8-4/h17-19H,5-16H2,1-4H3 |
| InChIKey | WNIBOWWGCXFBBW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174098549 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174098549?
The IUPAC name of CID 174098549 (CID 174098549) is not available.
What is the SMILES notation for CID 174098549?
The canonical SMILES for CID 174098549 is [B]CCC(CCOC(CCC)CCC)OC(CCC)CCC.
What is the InChIKey of CID 174098549?
The InChIKey is WNIBOWWGCXFBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39BO2/c1-5-9-17(10-6-2)21-16-14-19(13-15-20)22-18(11-7-3)12-8-4/h17-19H,5-16H2,1-4H3.
What are the key properties of CID 174098549?
CID 174098549 has a molecular weight of 310.33 g/mol, XLogP of 5.69, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174098549 is sourced from PubChem (CID 174098549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).