C10H17BO2 — CID 174098586
CID 174098586 (PubChem CID 174098586) has the molecular formula C10H17BO2 and a molecular weight of 180.06 g/mol.
| Compound Name | CID 174098586 |
|---|---|
| PubChem CID | 174098586 |
| Molecular Formula | C10H17BO2 |
| Molecular Weight | 180.06 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC[C@](C)(C(C)CC(C)=O)O1 |
| InChI | InChI=1S/C10H17BO2/c1-7(6-8(2)12)10(3)5-4-9(11)13-10/h7,9H,4-6H2,1-3H3/t7?,9-,10-/m1/s1 |
| InChIKey | SWDQGSKETJQVEN-RWBYNWAKSA-N |
| XLogP | 1.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.06 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|