About (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one
(2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one (PubChem CID 129233624) has the molecular formula C15H25IO2
and a molecular weight of 364.27 g/mol. Its IUPAC name is (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one |
| PubChem CID | 129233624 |
| Molecular Formula | C15H25IO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one |
| SMILES | CC(=O)C[C@@H](C)[C@]1(C)CCC(C)(C)C(CI)C1=O |
| InChI | InChI=1S/C15H25IO2/c1-10(8-11(2)17)15(5)7-6-14(3,4)12(9-16)13(15)18/h10,12H,6-9H2,1-5H3/t10-,12?,15+/m1/s1 |
| InChIKey | YBYWGEDPDKMFMB-GGYMPCQUSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one?
The IUPAC name of (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one (CID 129233624) is (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one.
What is the SMILES notation for (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one?
The canonical SMILES for (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one is CC(=O)C[C@@H](C)[C@]1(C)CCC(C)(C)C(CI)C1=O.
What is the InChIKey of (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one?
The InChIKey is YBYWGEDPDKMFMB-GGYMPCQUSA-N. The full InChI is InChI=1S/C15H25IO2/c1-10(8-11(2)17)15(5)7-6-14(3,4)12(9-16)13(15)18/h10,12H,6-9H2,1-5H3/t10-,12?,15+/m1/s1.
What are the key properties of (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one?
(2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one has a molecular weight of 364.27 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-(iodomethyl)-2,5,5-trimethyl-2-[(2R)-4-oxopentan-2-yl]cyclohexan-1-one is sourced from PubChem (CID 129233624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).