C39H40N2Si+2 — CID 174099755
[6-ethenyl-7-(1-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-2-propan-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane (PubChem CID 174099755) has the molecular formula C39H40N2Si+2 and a molecular weight of 564.85 g/mol. Its IUPAC name is [6-ethenyl-7-(1-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-2-propan-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane.
| Compound Name | [6-ethenyl-7-(1-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-2-propan-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 174099755 |
| Molecular Formula | C39H40N2Si+2 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [6-ethenyl-7-(1-phenyl-6H-pyrido[2,1-a]isoindol-5-ium-6-yl)-2-propan-2-yl-6,7-dihydrobenzo[a]quinolizin-5-ium-3-yl]-trimethylsilane |
| SMILES | C=CC1C(C2c3ccccc3-c3c(-c4ccccc4)ccc[n+]32)c2ccccc2-c2cc(C(C)C)c([Si](C)(C)C)c[n+]21 |
| InChI | InChI=1S/C39H40N2Si/c1-7-34-37(30-19-12-11-18-29(30)35-24-33(26(2)3)36(25-41(34)35)42(4,5)6)39-32-21-14-13-20-31(32)38-28(22-15-23-40(38)39)27-16-9-8-10-17-27/h7-26,34,37,39H,1H2,2-6H3/q+2 |
| InChIKey | VJELPVOSLNYISO-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|