C23H22B4N4O5 — CID 174100395
CID 174100395 (PubChem CID 174100395) has the molecular formula C23H22B4N4O5 and a molecular weight of 477.70 g/mol.
| Compound Name | CID 174100395 |
|---|---|
| PubChem CID | 174100395 |
| Molecular Formula | C23H22B4N4O5 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2ccc(OC3CCN(c4nn5c(=O)ccnc5c(COC)c4C)CC3)cc2OC1([B])[B] |
| InChI | InChI=1S/C23H22B4N4O5/c1-13-16(12-33-2)21-28-8-5-19(32)31(21)29-20(13)30-9-6-14(7-10-30)34-15-3-4-17-18(11-15)36-23(26,27)22(24,25)35-17/h3-5,8,11,14H,6-7,9-10,12H2,1-2H3 |
| InChIKey | KCEGSYLBFPNWTD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|