C23H20B4F2N4O4 — CID 174100383
CID 174100383 (PubChem CID 174100383) has the molecular formula C23H20B4F2N4O4 and a molecular weight of 497.68 g/mol.
| Compound Name | CID 174100383 |
|---|---|
| PubChem CID | 174100383 |
| Molecular Formula | C23H20B4F2N4O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2ccc(OC3CCN(c4nn5c(=O)cc(C(F)F)nc5c(C)c4C)CC3)cc2OC1([B])[B] |
| InChI | InChI=1S/C23H20B4F2N4O4/c1-11-12(2)21(31-33-18(34)10-15(19(28)29)30-20(11)33)32-7-5-13(6-8-32)35-14-3-4-16-17(9-14)37-23(26,27)22(24,25)36-16/h3-4,9-10,13,19H,5-8H2,1-2H3 |
| InChIKey | SACKKPAAXVMPJK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|