C22H21BF2N4O4 — CID 174100438
CID 174100438 (PubChem CID 174100438) has the molecular formula C22H21BF2N4O4 and a molecular weight of 454.24 g/mol.
| Compound Name | CID 174100438 |
|---|---|
| PubChem CID | 174100438 |
| Molecular Formula | C22H21BF2N4O4 |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | — |
| SMILES | [B]C1(Oc2ccc3c(c2)OCCO3)CCN(c2nn3c(=O)cc(C(F)F)nc3cc2C)CC1 |
| InChI | InChI=1S/C22H21BF2N4O4/c1-13-10-18-26-15(20(24)25)12-19(30)29(18)27-21(13)28-6-4-22(23,5-7-28)33-14-2-3-16-17(11-14)32-9-8-31-16/h2-3,10-12,20H,4-9H2,1H3 |
| InChIKey | DOQFTPKZWKIGRY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|