C24H22B4N4O4 — CID 174100385
CID 174100385 (PubChem CID 174100385) has the molecular formula C24H22B4N4O4 and a molecular weight of 473.71 g/mol.
| Compound Name | CID 174100385 |
|---|---|
| PubChem CID | 174100385 |
| Molecular Formula | C24H22B4N4O4 |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | — |
| SMILES | [B]C1([B])Oc2ccc(OC3CCN(c4nn5c(=O)cc(C6CC6)nc5cc4C)CC3)cc2OC1([B])[B] |
| InChI | InChI=1S/C24H22B4N4O4/c1-13-10-20-29-17(14-2-3-14)12-21(33)32(20)30-22(13)31-8-6-15(7-9-31)34-16-4-5-18-19(11-16)36-24(27,28)23(25,26)35-18/h4-5,10-12,14-15H,2-3,6-9H2,1H3 |
| InChIKey | VUZJGZBXOTWPJI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|