C22H32BrN5O3 — CID 174104484
tert-butyl (5R)-8-bromo-5-[(3-tert-butylimino-2-hydrazinylidenepropanoyl)amino]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate (PubChem CID 174104484) has the molecular formula C22H32BrN5O3 and a molecular weight of 494.43 g/mol. Its IUPAC name is tert-butyl (5R)-8-bromo-5-[(3-tert-butylimino-2-hydrazinylidenepropanoyl)amino]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate.
| Compound Name | tert-butyl (5R)-8-bromo-5-[(3-tert-butylimino-2-hydrazinylidenepropanoyl)amino]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 174104484 |
| Molecular Formula | C22H32BrN5O3 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | tert-butyl (5R)-8-bromo-5-[(3-tert-butylimino-2-hydrazinylidenepropanoyl)amino]-1,3,4,5-tetrahydro-2-benzazepine-2-carboxylate |
| SMILES | CC(C)(C)/N=C/C(=NN)C(=O)N[C@@H]1CCN(C(=O)OC(C)(C)C)Cc2cc(Br)ccc21 |
| InChI | InChI=1S/C22H32BrN5O3/c1-21(2,3)25-12-18(27-24)19(29)26-17-9-10-28(20(30)31-22(4,5)6)13-14-11-15(23)7-8-16(14)17/h7-8,11-12,17H,9-10,13,24H2,1-6H3,(H,26,29)/b25-12+,27-18?/t17-/m1/s1 |
| InChIKey | MMZMKJUXOIRETL-PKEZIOQOSA-N |
| XLogP | 3.93 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|