C10H13BrF3NOS2 — CID 174107322
[[1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174107322) has the molecular formula C10H13BrF3NOS2 and a molecular weight of 364.25 g/mol. Its IUPAC name is [[1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174107322 |
| Molecular Formula | C10H13BrF3NOS2 |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | [[1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(c1cc(Br)cs1)C(F)(F)F |
| InChI | InChI=1S/C10H13BrF3NOS2/c1-9(2,3)18(16)15-8(10(12,13)14)7-4-6(11)5-17-7/h4-5,8,15H,1-3H3 |
| InChIKey | LAWDPNWCNLWMKX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|