C14H28S — CID 174108762
(2R)-2-[(1S,2R)-1,2-dimethylcyclononyl]propane-1-thiol (PubChem CID 174108762) has the molecular formula C14H28S and a molecular weight of 228.44 g/mol. Its IUPAC name is (2R)-2-[(1S,2R)-1,2-dimethylcyclononyl]propane-1-thiol.
| Compound Name | (2R)-2-[(1S,2R)-1,2-dimethylcyclononyl]propane-1-thiol |
|---|---|
| PubChem CID | 174108762 |
| Molecular Formula | C14H28S |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (2R)-2-[(1S,2R)-1,2-dimethylcyclononyl]propane-1-thiol |
| SMILES | C[C@@H]1CCCCCCC[C@]1(C)[C@@H](C)CS |
| InChI | InChI=1S/C14H28S/c1-12-9-7-5-4-6-8-10-14(12,3)13(2)11-15/h12-13,15H,4-11H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | GEEXFEGVKZAROG-RDBSUJKOSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|