C19H27N3O9 — CID 174112503
[(2R,5S)-3,4-diacetyloxy-5-[1-[2-(dimethylamino)ethyl]-2,4-dioxopyrimidin-5-yl]oxolan-2-yl]methyl acetate (PubChem CID 174112503) has the molecular formula C19H27N3O9 and a molecular weight of 441.44 g/mol. Its IUPAC name is [(2R,5S)-3,4-diacetyloxy-5-[1-[2-(dimethylamino)ethyl]-2,4-dioxopyrimidin-5-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,5S)-3,4-diacetyloxy-5-[1-[2-(dimethylamino)ethyl]-2,4-dioxopyrimidin-5-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 174112503 |
| Molecular Formula | C19H27N3O9 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | [(2R,5S)-3,4-diacetyloxy-5-[1-[2-(dimethylamino)ethyl]-2,4-dioxopyrimidin-5-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](c2cn(CCN(C)C)c(=O)[nH]c2=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H27N3O9/c1-10(23)28-9-14-16(29-11(2)24)17(30-12(3)25)15(31-14)13-8-22(7-6-21(4)5)19(27)20-18(13)26/h8,14-17H,6-7,9H2,1-5H3,(H,20,26,27)/t14-,15+,16?,17?/m1/s1 |
| InChIKey | ARXXBBIYFKFIQR-XNIRIUNOSA-N |
| XLogP | -1.04 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|