C17H28ClF2N3O3Si — CID 174114269
4-amino-1-[(2R,3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3-fluoro-4-methyloxolan-2-yl]-5-fluoropyrimidin-2-one (PubChem CID 174114269) has the molecular formula C17H28ClF2N3O3Si and a molecular weight of 423.96 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3-fluoro-4-methyloxolan-2-yl]-5-fluoropyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3-fluoro-4-methyloxolan-2-yl]-5-fluoropyrimidin-2-one |
|---|---|
| PubChem CID | 174114269 |
| Molecular Formula | C17H28ClF2N3O3Si |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-amino-1-[(2R,3S,4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(chloromethyl)-3-fluoro-4-methyloxolan-2-yl]-5-fluoropyrimidin-2-one |
| SMILES | C[C@H]1[C@H](F)[C@H](n2cc(F)c(N)nc2=O)O[C@]1(CCl)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28ClF2N3O3Si/c1-10-12(20)14(23-7-11(19)13(21)22-15(23)24)26-17(10,8-18)9-25-27(5,6)16(2,3)4/h7,10,12,14H,8-9H2,1-6H3,(H2,21,22,24)/t10-,12-,14+,17+/m0/s1 |
| InChIKey | UVPANLCIGADKFE-IMLJOKKJSA-N |
| XLogP | 3.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|