C19H35N — CID 174115735
(Z)-2-tert-butyl-4,5,10,10-tetramethylundec-7-enenitrile (PubChem CID 174115735) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (Z)-2-tert-butyl-4,5,10,10-tetramethylundec-7-enenitrile.
| Compound Name | (Z)-2-tert-butyl-4,5,10,10-tetramethylundec-7-enenitrile |
|---|---|
| PubChem CID | 174115735 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (Z)-2-tert-butyl-4,5,10,10-tetramethylundec-7-enenitrile |
| SMILES | CC(C/C=C\CC(C)(C)C)C(C)CC(C#N)C(C)(C)C |
| InChI | InChI=1S/C19H35N/c1-15(11-9-10-12-18(3,4)5)16(2)13-17(14-20)19(6,7)8/h9-10,15-17H,11-13H2,1-8H3/b10-9- |
| InChIKey | VFCKSKHSUPKNEN-KTKRTIGZSA-N |
| XLogP | 6.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|