C13H19N8O12P3 — CID 174116763
[[(2R,4S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-5-methyl-3-oxabicyclo[4.1.0]heptan-4-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174116763) has the molecular formula C13H19N8O12P3 and a molecular weight of 572.26 g/mol. Its IUPAC name is [[(2R,4S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-5-methyl-3-oxabicyclo[4.1.0]heptan-4-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-5-methyl-3-oxabicyclo[4.1.0]heptan-4-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174116763 |
| Molecular Formula | C13H19N8O12P3 |
| Molecular Weight | 572.26 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | [[(2R,4S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-azido-5-methyl-3-oxabicyclo[4.1.0]heptan-4-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1(N=[N+]=[N-])C2CC2[C@H](n2cnc3c(=O)[nH]c(N)nc32)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C13H19N8O12P3/c1-13(19-20-15)6-2-5(6)11(21-4-16-8-9(21)17-12(14)18-10(8)22)31-7(13)3-30-35(26,27)33-36(28,29)32-34(23,24)25/h4-7,11H,2-3H2,1H3,(H,26,27)(H,28,29)(H2,23,24,25)(H3,14,17,18,22)/t5?,6?,7-,11-,13?/m1/s1 |
| InChIKey | YXTGWJGHUNVQJQ-KCLYGPAWSA-N |
| XLogP | 0.65 |
| TPSA | 307.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|