C44H28B3N3O2 — CID 174118294
CID 174118294 (PubChem CID 174118294) has the molecular formula C44H28B3N3O2 and a molecular weight of 663.16 g/mol.
| Compound Name | CID 174118294 |
|---|---|
| PubChem CID | 174118294 |
| Molecular Formula | C44H28B3N3O2 |
| Molecular Weight | 663.16 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C([B])(O)c1nc2ccccc2n1-c1ccc(-c2c3ccccc3c(-c3cccc(-c4ccncc4)c3)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C44H28B3N3O2/c45-43(51,44(46,47)52)42-49-37-18-7-8-19-39(37)50(42)38-21-20-36(30-12-1-2-13-31(30)38)41-34-16-5-3-14-32(34)40(33-15-4-6-17-35(33)41)29-11-9-10-28(26-29)27-22-24-48-25-23-27/h1-26,51-52H |
| InChIKey | LSSTYKJDMXFOAE-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.16 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|