C49H19B13N2 — CID 174118594
CID 174118594 (PubChem CID 174118594) has the molecular formula C49H19B13N2 and a molecular weight of 776.26 g/mol.
| Compound Name | CID 174118594 |
|---|---|
| PubChem CID | 174118594 |
| Molecular Formula | C49H19B13N2 |
| Molecular Weight | 776.26 g/mol |
| Exact Mass | 778.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(-c3c4c([B])c([B])c([B])c([B])c4c(-c4ccc(-c5nc6ccccc6n5-c5cccc6ccccc56)cc4)c4c([B])c([B])c([B])c([B])c34)cc2)c([B])c1[B] |
| InChI | InChI=1S/C49H19B13N2/c50-36-31(37(51)43(57)48(62)42(36)56)23-14-12-21(13-15-23)29-32-34(40(54)46(60)44(58)38(32)52)30(35-33(29)39(53)45(59)47(61)41(35)55)22-16-18-24(19-17-22)49-63-26-9-3-4-10-28(26)64(49)27-11-5-7-20-6-1-2-8-25(20)27/h1-19H |
| InChIKey | HEKLQICOZZUIBK-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 64 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.26 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|