C19H21N3O5 — CID 17412374
3-hydroxy-N-methyl-4-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide (PubChem CID 17412374) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 3-hydroxy-N-methyl-4-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide.
| Compound Name | 3-hydroxy-N-methyl-4-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 17412374 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-hydroxy-N-methyl-4-nitro-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)c2ccc([N+](=O)[O-])c(O)c2)c(C)c1 |
| InChI | InChI=1S/C19H21N3O5/c1-11-7-12(2)18(13(3)8-11)20-17(24)10-21(4)19(25)14-5-6-15(22(26)27)16(23)9-14/h5-9,23H,10H2,1-4H3,(H,20,24) |
| InChIKey | NLKTYVIZVYUHPB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|