About CID 174134759
CID 174134759 (PubChem CID 174134759) has the molecular formula C51H16B18N4S
and a molecular weight of 911.40 g/mol.
Molecular Properties
| Compound Name | CID 174134759 |
| PubChem CID | 174134759 |
| Molecular Formula | C51H16B18N4S |
| Molecular Weight | 911.40 g/mol |
| Exact Mass | 914.28 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c([B])c([B])c(N(c3c([B])c([B])c([B])c([B])c3[B])c3c([B])c([B])c(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5c(c4)sc4ccccc45)c([B])c3[B])c([B])c2[B])c([B])c1[B] |
| InChI | InChI=1S/C51H16B18N4S/c52-28-24(19-15-21(25-20-13-7-8-14-22(20)74-23(25)16-19)51-71-49(17-9-3-1-4-10-17)70-50(72-51)18-11-5-2-6-12-18)29(53)41(65)46(40(28)64)73(48-44(68)38(62)37(61)39(63)45(48)69)47-42(66)32(56)27(33(57)43(47)67)26-30(54)34(58)36(60)35(59)31(26)55/h1-16H |
| InChIKey | ZZFIUYKOBJSHON-UHFFFAOYSA-N |
| XLogP | -7.67 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 911.40 |
| LogP ≤ 5 | -7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174134759 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174134759?
The IUPAC name of CID 174134759 (CID 174134759) is not available.
What is the SMILES notation for CID 174134759?
The canonical SMILES for CID 174134759 is [B]c1c([B])c([B])c(-c2c([B])c([B])c(N(c3c([B])c([B])c([B])c([B])c3[B])c3c([B])c([B])c(-c4cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c5c(c4)sc4ccccc45)c([B])c3[B])c([B])c2[B])c([B])c1[B].
What is the InChIKey of CID 174134759?
The InChIKey is ZZFIUYKOBJSHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H16B18N4S/c52-28-24(19-15-21(25-20-13-7-8-14-22(20)74-23(25)16-19)51-71-49(17-9-3-1-4-10-17)70-50(72-51)18-11-5-2-6-12-18)29(53)41(65)46(40(28)64)73(48-44(68)38(62)37(61)39(63)45(48)69)47-42(66)32(56)27(33(57)43(47)67)26-30(54)34(58)36(60)35(59)31(26)55/h1-16H.
What are the key properties of CID 174134759?
CID 174134759 has a molecular weight of 911.40 g/mol, XLogP of -7.67, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174134759 is sourced from PubChem (CID 174134759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).