C39H58BN2O2 — CID 174136496
CID 174136496 (PubChem CID 174136496) has the molecular formula C39H58BN2O2 and a molecular weight of 597.72 g/mol.
| Compound Name | CID 174136496 |
|---|---|
| PubChem CID | 174136496 |
| Molecular Formula | C39H58BN2O2 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.46 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(C(=O)N[B]C3CCCCCCC3)CC[C@]3(C)C(=CCC4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C39H58BN2O2/c1-34(2)19-21-39(33(44)42-40-27-13-11-9-8-10-12-14-27)22-20-37(6)28(29(39)24-34)15-16-31-36(5)23-26(25-41)32(43)35(3,4)30(36)17-18-38(31,37)7/h15,23,27,29-31H,8-14,16-22,24H2,1-7H3,(H,42,44)/t29-,30-,31?,36-,37+,38+,39?/m0/s1 |
| InChIKey | LGTXUMHSEKEKEE-KGLPPRSZSA-N |
| XLogP | 9.30 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|