C12H14BrN5OS — CID 17413966
6-[2-(3-bromophenoxy)ethylsulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 17413966) has the molecular formula C12H14BrN5OS and a molecular weight of 356.25 g/mol. Its IUPAC name is 6-[2-(3-bromophenoxy)ethylsulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-(3-bromophenoxy)ethylsulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 17413966 |
| Molecular Formula | C12H14BrN5OS |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 6-[2-(3-bromophenoxy)ethylsulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CSCCOc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C12H14BrN5OS/c13-8-2-1-3-9(6-8)19-4-5-20-7-10-16-11(14)18-12(15)17-10/h1-3,6H,4-5,7H2,(H4,14,15,16,17,18) |
| InChIKey | JFIDIWYKBSMTEM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|