C11H13BrN2O2 — CID 44602508
(4S)-4-[2-(3-bromophenoxy)ethyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 44602508) has the molecular formula C11H13BrN2O2 and a molecular weight of 285.14 g/mol. Its IUPAC name is (4S)-4-[2-(3-bromophenoxy)ethyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[2-(3-bromophenoxy)ethyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 44602508 |
| Molecular Formula | C11H13BrN2O2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (4S)-4-[2-(3-bromophenoxy)ethyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@H](CCOc2cccc(Br)c2)CO1 |
| InChI | InChI=1S/C11H13BrN2O2/c12-8-2-1-3-10(6-8)15-5-4-9-7-16-11(13)14-9/h1-3,6,9H,4-5,7H2,(H2,13,14)/t9-/m0/s1 |
| InChIKey | UNMWRBOEACAPFU-VIFPVBQESA-N |
| XLogP | 1.93 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |