C17H13BrO3 — CID 71217262
2-[2-(3-bromophenoxy)ethyl]indene-1,3-dione (PubChem CID 71217262) has the molecular formula C17H13BrO3 and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethyl]indene-1,3-dione.
| Compound Name | 2-[2-(3-bromophenoxy)ethyl]indene-1,3-dione |
|---|---|
| PubChem CID | 71217262 |
| Molecular Formula | C17H13BrO3 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethyl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C17H13BrO3/c18-11-4-3-5-12(10-11)21-9-8-15-16(19)13-6-1-2-7-14(13)17(15)20/h1-7,10,15H,8-9H2 |
| InChIKey | JNNLCPYGJSTLJS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|