C12H14BrN3O2S — CID 175500701
3-[3-(3-bromophenoxy)propylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 175500701) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is 3-[3-(3-bromophenoxy)propylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[3-(3-bromophenoxy)propylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 175500701 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 3-[3-(3-bromophenoxy)propylsulfanylmethyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CSCCCOc2cccc(Br)c2)[nH]1 |
| InChI | InChI=1S/C12H14BrN3O2S/c13-9-3-1-4-10(7-9)18-5-2-6-19-8-11-14-12(17)16-15-11/h1,3-4,7H,2,5-6,8H2,(H2,14,15,16,17) |
| InChIKey | JTUFECJKNJKVFR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|