C22H26F2N10O9P2 — CID 174140544
[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl [(1S,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] hydrogen phosphate (PubChem CID 174140544) has the molecular formula C22H26F2N10O9P2 and a molecular weight of 674.46 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl [(1S,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] hydrogen phosphate.
| Compound Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl [(1S,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] hydrogen phosphate |
|---|---|
| PubChem CID | 174140544 |
| Molecular Formula | C22H26F2N10O9P2 |
| Molecular Weight | 674.46 g/mol |
| Exact Mass | 674.13 |
| IUPAC Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-fluorooxolan-2-yl]methyl [(1S,2R,3S,4R,5S)-4-(6-aminopurin-9-yl)-3-fluoro-1-(phosphonooxymethyl)-2-bicyclo[3.1.0]hexanyl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1[C@H](F)[C@H](OP(=O)(O)OC[C@@H]2C[C@@H](F)[C@H](n3cnc4c(N)ncnc43)O2)[C@@]2(COP(=O)(O)O)C[C@H]12 |
| InChI | InChI=1S/C22H26F2N10O9P2/c23-11-1-9(42-21(11)34-8-32-14-18(26)28-6-30-20(14)34)3-40-45(38,39)43-16-12(24)15(10-2-22(10,16)4-41-44(35,36)37)33-7-31-13-17(25)27-5-29-19(13)33/h5-12,15-16,21H,1-4H2,(H,38,39)(H2,25,27,29)(H2,26,28,30)(H2,35,36,37)/t9-,10+,11+,12-,15+,16-,21+,22+/m0/s1 |
| InChIKey | ANBLSUNOOSVDHC-HOSFBUHUSA-N |
| XLogP | 0.97 |
| TPSA | 270.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|