C34H37B2FN8O5S2 — CID 174140997
CID 174140997 (PubChem CID 174140997) has the molecular formula C34H37B2FN8O5S2 and a molecular weight of 742.48 g/mol.
| Compound Name | CID 174140997 |
|---|---|
| PubChem CID | 174140997 |
| Molecular Formula | C34H37B2FN8O5S2 |
| Molecular Weight | 742.48 g/mol |
| Exact Mass | 742.25 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C(C(=O)Nc2ccc(CNC(=O)N3CCC(N4CCN(C(=O)CCSSc5ccc([N+](=O)[O-])cn5)CC4)CC3)c(F)c2)C1c1cccnc1 |
| InChI | InChI=1S/C34H37B2FN8O5S2/c35-34(36)30(23-2-1-10-38-19-23)31(34)32(47)41-24-4-3-22(27(37)18-24)20-40-33(48)44-11-7-25(8-12-44)42-13-15-43(16-14-42)29(46)9-17-51-52-28-6-5-26(21-39-28)45(49)50/h1-6,10,18-19,21,25,30-31H,7-9,11-17,20H2,(H,40,48)(H,41,47) |
| InChIKey | PNQQHFBGWUHDDU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|