C22H20F2N2O2S — CID 174141721
[2-[(2R)-1-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropanecarbonyl]azetidin-2-yl]ethynylamino]-methyl-oxidosulfanium (PubChem CID 174141721) has the molecular formula C22H20F2N2O2S and a molecular weight of 414.48 g/mol. Its IUPAC name is [2-[(2R)-1-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropanecarbonyl]azetidin-2-yl]ethynylamino]-methyl-oxidosulfanium.
| Compound Name | [2-[(2R)-1-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropanecarbonyl]azetidin-2-yl]ethynylamino]-methyl-oxidosulfanium |
|---|---|
| PubChem CID | 174141721 |
| Molecular Formula | C22H20F2N2O2S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-[(2R)-1-[(1R,2R)-2-[2-(2,6-difluorophenyl)phenyl]cyclopropanecarbonyl]azetidin-2-yl]ethynylamino]-methyl-oxidosulfanium |
| SMILES | C[S+]([O-])NC#C[C@H]1CCN1C(=O)[C@@H]1C[C@H]1c1ccccc1-c1c(F)cccc1F |
| InChI | InChI=1S/C22H20F2N2O2S/c1-29(28)25-11-9-14-10-12-26(14)22(27)18-13-17(18)15-5-2-3-6-16(15)21-19(23)7-4-8-20(21)24/h2-8,14,17-18,25H,10,12-13H2,1H3/t14-,17-,18+,29?/m0/s1 |
| InChIKey | VKCKMWZPCPIBHS-QERHYCGOSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|