C14H26BO6 — CID 174141787
CID 174141787 (PubChem CID 174141787) has the molecular formula C14H26BO6 and a molecular weight of 301.17 g/mol.
| Compound Name | CID 174141787 |
|---|---|
| PubChem CID | 174141787 |
| Molecular Formula | C14H26BO6 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)OCC(O)[B]C(CO)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H26BO6/c1-13(2,3)11(18)20-8-9(17)15-10(7-16)21-12(19)14(4,5)6/h9-10,16-17H,7-8H2,1-6H3 |
| InChIKey | SHXMZHLOLAUAOJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|