C20H32FN5OSi — CID 174143437
2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 174143437) has the molecular formula C20H32FN5OSi and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 174143437 |
| Molecular Formula | C20H32FN5OSi |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | Cn1nc(NCC(=O)NCc2cccnc2)cc1[Si](F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H32FN5OSi/c1-19(2,3)28(21,20(4,5)6)18-11-16(25-26(18)7)23-14-17(27)24-13-15-9-8-10-22-12-15/h8-12H,13-14H2,1-7H3,(H,23,25)(H,24,27) |
| InChIKey | ZUMPOYPWARPTAG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|