C22H35FN6O2Si — CID 174144136
2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide (PubChem CID 174144136) has the molecular formula C22H35FN6O2Si and a molecular weight of 462.65 g/mol. Its IUPAC name is 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide.
| Compound Name | 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 174144136 |
| Molecular Formula | C22H35FN6O2Si |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 2-[[5-[ditert-butyl(fluoro)silyl]-1-methylpyrazol-3-yl]amino]-N-[2-oxo-2-(pyridin-3-ylmethylamino)ethyl]acetamide |
| SMILES | Cn1nc(NCC(=O)NCC(=O)NCc2cccnc2)cc1[Si](F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H35FN6O2Si/c1-21(2,3)32(23,22(4,5)6)20-11-17(28-29(20)7)25-14-18(30)27-15-19(31)26-13-16-9-8-10-24-12-16/h8-12H,13-15H2,1-7H3,(H,25,28)(H,26,31)(H,27,30) |
| InChIKey | GSPBSCHJHDSZLO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|