C17H15ClN2O5 — CID 17414414
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-amino-3-chlorobenzoate (PubChem CID 17414414) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-amino-3-chlorobenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-amino-3-chlorobenzoate |
|---|---|
| PubChem CID | 17414414 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 2-amino-3-chlorobenzoate |
| SMILES | Nc1c(Cl)cccc1C(=O)OCC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15ClN2O5/c18-12-3-1-2-11(16(12)19)17(22)23-8-15(21)20-7-10-4-5-13-14(6-10)25-9-24-13/h1-6H,7-9,19H2,(H,20,21) |
| InChIKey | NIQYBSARBPOBSN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|