C32H35BF3N3O4 — CID 174147542
2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 174147542) has the molecular formula C32H35BF3N3O4 and a molecular weight of 593.46 g/mol. Its IUPAC name is 2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 174147542 |
| Molecular Formula | C32H35BF3N3O4 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | 2-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]-6-[2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | CC1(C)OB(c2cccc(C3(c4nc5c(c(=O)[nH]4)CN(C(=O)Cc4cccc(C(F)(F)F)c4)CCC5)CC3)c2)OC1(C)C |
| InChI | InChI=1S/C32H35BF3N3O4/c1-29(2)30(3,4)43-33(42-29)23-11-6-9-21(18-23)31(13-14-31)28-37-25-12-7-15-39(19-24(25)27(41)38-28)26(40)17-20-8-5-10-22(16-20)32(34,35)36/h5-6,8-11,16,18H,7,12-15,17,19H2,1-4H3,(H,37,38,41) |
| InChIKey | LWVLOUONGIREDV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|